![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| job.xml | 18-Dec-2017 15:51 | 672 | |
| LU_Consumer_Information.pdf | 12-Dec-2017 15:04 | 743K | |
| LU_Annual_Crime_Report_2017.pdf | 01-Nov-2017 13:25 | 273K | |
| Form_1098T.pdf | 12-Sep-2017 16:45 | 21K | |
| DoComments/ | 11-Sep-2017 15:08 | - | |
| Completion_Registration_Reminder.pdf | 07-Sep-2017 12:49 | 130K | |
| LU_Annual_Crime_Report_2016.pdf | 28-Aug-2017 12:59 | 430K | |
| LU Policy of Withdrawal and Return of Title IV Funds.pdf | 16-Aug-2017 14:32 | 64K | |
| Disability Policy and Accomodation Procedure.pdf | 16-Aug-2017 14:32 | 153K | |
| Drug and Alcohol-Free Policy.pdf | 16-Aug-2017 14:32 | 92K | |